C12H15N3O — CID 115207431
N-(azetidin-3-ylmethyl)-N-methyl-1,3-benzoxazol-6-amine (PubChem CID 115207431) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is N-(azetidin-3-ylmethyl)-N-methyl-1,3-benzoxazol-6-amine.
| Compound Name | N-(azetidin-3-ylmethyl)-N-methyl-1,3-benzoxazol-6-amine |
|---|---|
| PubChem CID | 115207431 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | N-(azetidin-3-ylmethyl)-N-methyl-1,3-benzoxazol-6-amine |
| SMILES | CN(CC1CNC1)c1ccc2ncoc2c1 |
| InChI | InChI=1S/C12H15N3O/c1-15(7-9-5-13-6-9)10-2-3-11-12(4-10)16-8-14-11/h2-4,8-9,13H,5-7H2,1H3 |
| InChIKey | ZZTDUKHCKJYSTF-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |