About N-(3-chloropropyl)-N-methyl-1,3-benzoxazol-6-amine
N-(3-chloropropyl)-N-methyl-1,3-benzoxazol-6-amine (PubChem CID 115215548) has the molecular formula C11H13ClN2O
and a molecular weight of 224.69 g/mol. Its IUPAC name is N-(3-chloropropyl)-N-methyl-1,3-benzoxazol-6-amine.
Molecular Properties
| Compound Name | N-(3-chloropropyl)-N-methyl-1,3-benzoxazol-6-amine |
| PubChem CID | 115215548 |
| Molecular Formula | C11H13ClN2O |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | N-(3-chloropropyl)-N-methyl-1,3-benzoxazol-6-amine |
| SMILES | CN(CCCCl)c1ccc2ncoc2c1 |
| InChI | InChI=1S/C11H13ClN2O/c1-14(6-2-5-12)9-3-4-10-11(7-9)15-8-13-10/h3-4,7-8H,2,5-6H2,1H3 |
| InChIKey | AYUGPILLDVBTRJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(3-chloropropyl)-N-methyl-1,3-benzoxazol-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-chloropropyl)-N-methyl-1,3-benzoxazol-6-amine?
The IUPAC name of N-(3-chloropropyl)-N-methyl-1,3-benzoxazol-6-amine (CID 115215548) is N-(3-chloropropyl)-N-methyl-1,3-benzoxazol-6-amine.
What is the SMILES notation for N-(3-chloropropyl)-N-methyl-1,3-benzoxazol-6-amine?
The canonical SMILES for N-(3-chloropropyl)-N-methyl-1,3-benzoxazol-6-amine is CN(CCCCl)c1ccc2ncoc2c1.
What is the InChIKey of N-(3-chloropropyl)-N-methyl-1,3-benzoxazol-6-amine?
The InChIKey is AYUGPILLDVBTRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClN2O/c1-14(6-2-5-12)9-3-4-10-11(7-9)15-8-13-10/h3-4,7-8H,2,5-6H2,1H3.
What are the key properties of N-(3-chloropropyl)-N-methyl-1,3-benzoxazol-6-amine?
N-(3-chloropropyl)-N-methyl-1,3-benzoxazol-6-amine has a molecular weight of 224.69 g/mol, XLogP of 2.89, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-chloropropyl)-N-methyl-1,3-benzoxazol-6-amine is sourced from PubChem (CID 115215548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).