C11H13ClN2O — CID 115215548
N-(3-chloropropyl)-N-methyl-1,3-benzoxazol-6-amine (PubChem CID 115215548) has the molecular formula C11H13ClN2O and a molecular weight of 224.69 g/mol. Its IUPAC name is N-(3-chloropropyl)-N-methyl-1,3-benzoxazol-6-amine.
| Compound Name | N-(3-chloropropyl)-N-methyl-1,3-benzoxazol-6-amine |
|---|---|
| PubChem CID | 115215548 |
| Molecular Formula | C11H13ClN2O |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | N-(3-chloropropyl)-N-methyl-1,3-benzoxazol-6-amine |
| SMILES | CN(CCCCl)c1ccc2ncoc2c1 |
| InChI | InChI=1S/C11H13ClN2O/c1-14(6-2-5-12)9-3-4-10-11(7-9)15-8-13-10/h3-4,7-8H,2,5-6H2,1H3 |
| InChIKey | AYUGPILLDVBTRJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|