C12H14N2O3 — CID 115178685
N-(1,3-benzoxazol-6-yl)-2-hydroxy-N,2-dimethylpropanamide (PubChem CID 115178685) has the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. Its IUPAC name is N-(1,3-benzoxazol-6-yl)-2-hydroxy-N,2-dimethylpropanamide.
| Compound Name | N-(1,3-benzoxazol-6-yl)-2-hydroxy-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 115178685 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | N-(1,3-benzoxazol-6-yl)-2-hydroxy-N,2-dimethylpropanamide |
| SMILES | CN(C(=O)C(C)(C)O)c1ccc2ncoc2c1 |
| InChI | InChI=1S/C12H14N2O3/c1-12(2,16)11(15)14(3)8-4-5-9-10(6-8)17-7-13-9/h4-7,16H,1-3H3 |
| InChIKey | IATOMFDDXKRALY-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |