C14H19N3O2 — CID 115157280
4-amino-N-(1,3-benzoxazol-6-yl)-N,3,3-trimethylbutanamide (PubChem CID 115157280) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 4-amino-N-(1,3-benzoxazol-6-yl)-N,3,3-trimethylbutanamide.
| Compound Name | 4-amino-N-(1,3-benzoxazol-6-yl)-N,3,3-trimethylbutanamide |
|---|---|
| PubChem CID | 115157280 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 4-amino-N-(1,3-benzoxazol-6-yl)-N,3,3-trimethylbutanamide |
| SMILES | CN(C(=O)CC(C)(C)CN)c1ccc2ncoc2c1 |
| InChI | InChI=1S/C14H19N3O2/c1-14(2,8-15)7-13(18)17(3)10-4-5-11-12(6-10)19-9-16-11/h4-6,9H,7-8,15H2,1-3H3 |
| InChIKey | OXEGKLYDLRQUES-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |