C11H14ClN3 — CID 115215551
N-(3-chloropropyl)-N-methyl-3H-benzimidazol-5-amine (PubChem CID 115215551) has the molecular formula C11H14ClN3 and a molecular weight of 223.71 g/mol. Its IUPAC name is N-(3-chloropropyl)-N-methyl-3H-benzimidazol-5-amine.
| Compound Name | N-(3-chloropropyl)-N-methyl-3H-benzimidazol-5-amine |
|---|---|
| PubChem CID | 115215551 |
| Molecular Formula | C11H14ClN3 |
| Molecular Weight | 223.71 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | N-(3-chloropropyl)-N-methyl-3H-benzimidazol-5-amine |
| SMILES | CN(CCCCl)c1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C11H14ClN3/c1-15(6-2-5-12)9-3-4-10-11(7-9)14-8-13-10/h3-4,7-8H,2,5-6H2,1H3,(H,13,14) |
| InChIKey | NRKDPJUQUCGPCM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.71 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|