C14H22N2 — CID 62556066
N'-(3,5-dimethylphenyl)-N'-methyl-N-prop-2-enylethane-1,2-diamine (PubChem CID 62556066) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is N'-(3,5-dimethylphenyl)-N'-methyl-N-prop-2-enylethane-1,2-diamine.
| Compound Name | N'-(3,5-dimethylphenyl)-N'-methyl-N-prop-2-enylethane-1,2-diamine |
|---|---|
| PubChem CID | 62556066 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | N'-(3,5-dimethylphenyl)-N'-methyl-N-prop-2-enylethane-1,2-diamine |
| SMILES | C=CCNCCN(C)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C14H22N2/c1-5-6-15-7-8-16(4)14-10-12(2)9-13(3)11-14/h5,9-11,15H,1,6-8H2,2-4H3 |
| InChIKey | PMDVAROCYNBPMR-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|