C13H21FN2 — CID 62437244
N-ethyl-N'-(3-fluorophenyl)-N'-methylbutane-1,4-diamine (PubChem CID 62437244) has the molecular formula C13H21FN2 and a molecular weight of 224.32 g/mol. Its IUPAC name is N-ethyl-N'-(3-fluorophenyl)-N'-methylbutane-1,4-diamine.
| Compound Name | N-ethyl-N'-(3-fluorophenyl)-N'-methylbutane-1,4-diamine |
|---|---|
| PubChem CID | 62437244 |
| Molecular Formula | C13H21FN2 |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.17 |
| IUPAC Name | N-ethyl-N'-(3-fluorophenyl)-N'-methylbutane-1,4-diamine |
| SMILES | CCNCCCCN(C)c1cccc(F)c1 |
| InChI | InChI=1S/C13H21FN2/c1-3-15-9-4-5-10-16(2)13-8-6-7-12(14)11-13/h6-8,11,15H,3-5,9-10H2,1-2H3 |
| InChIKey | FJSKYDSWHBEOJP-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|