C10H14IN — CID 130693336
N-(2-iodoethyl)-N,3-dimethylaniline (PubChem CID 130693336) has the molecular formula C10H14IN and a molecular weight of 275.13 g/mol. Its IUPAC name is N-(2-iodoethyl)-N,3-dimethylaniline.
| Compound Name | N-(2-iodoethyl)-N,3-dimethylaniline |
|---|---|
| PubChem CID | 130693336 |
| Molecular Formula | C10H14IN |
| Molecular Weight | 275.13 g/mol |
| Exact Mass | 275.02 |
| IUPAC Name | N-(2-iodoethyl)-N,3-dimethylaniline |
| SMILES | Cc1cccc(N(C)CCI)c1 |
| InChI | InChI=1S/C10H14IN/c1-9-4-3-5-10(8-9)12(2)7-6-11/h3-5,8H,6-7H2,1-2H3 |
| InChIKey | LYYKCYAPIAZJLD-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.13 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|