C15H27NOSi — CID 174067279
N-[3-[ethoxy(dimethyl)silyl]propyl]-N,3-dimethylaniline (PubChem CID 174067279) has the molecular formula C15H27NOSi and a molecular weight of 265.47 g/mol. Its IUPAC name is N-[3-[ethoxy(dimethyl)silyl]propyl]-N,3-dimethylaniline.
| Compound Name | N-[3-[ethoxy(dimethyl)silyl]propyl]-N,3-dimethylaniline |
|---|---|
| PubChem CID | 174067279 |
| Molecular Formula | C15H27NOSi |
| Molecular Weight | 265.47 g/mol |
| Exact Mass | 265.19 |
| IUPAC Name | N-[3-[ethoxy(dimethyl)silyl]propyl]-N,3-dimethylaniline |
| SMILES | CCO[Si](C)(C)CCCN(C)c1cccc(C)c1 |
| InChI | InChI=1S/C15H27NOSi/c1-6-17-18(4,5)12-8-11-16(3)15-10-7-9-14(2)13-15/h7,9-10,13H,6,8,11-12H2,1-5H3 |
| InChIKey | KAMYNHCCKFDICN-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|