About 2-amino-4-(N,3-dimethylanilino)butanenitrile
2-amino-4-(N,3-dimethylanilino)butanenitrile (PubChem CID 63027364) has the molecular formula C12H17N3
and a molecular weight of 203.29 g/mol. Its IUPAC name is 2-amino-4-(N,3-dimethylanilino)butanenitrile.
Molecular Properties
| Compound Name | 2-amino-4-(N,3-dimethylanilino)butanenitrile |
| PubChem CID | 63027364 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | 2-amino-4-(N,3-dimethylanilino)butanenitrile |
| SMILES | Cc1cccc(N(C)CCC(N)C#N)c1 |
| InChI | InChI=1S/C12H17N3/c1-10-4-3-5-12(8-10)15(2)7-6-11(14)9-13/h3-5,8,11H,6-7,14H2,1-2H3 |
| InChIKey | ZPECEJYCNGSACG-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-4-(N,3-dimethylanilino)butanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-(N,3-dimethylanilino)butanenitrile?
The IUPAC name of 2-amino-4-(N,3-dimethylanilino)butanenitrile (CID 63027364) is 2-amino-4-(N,3-dimethylanilino)butanenitrile.
What is the SMILES notation for 2-amino-4-(N,3-dimethylanilino)butanenitrile?
The canonical SMILES for 2-amino-4-(N,3-dimethylanilino)butanenitrile is Cc1cccc(N(C)CCC(N)C#N)c1.
What is the InChIKey of 2-amino-4-(N,3-dimethylanilino)butanenitrile?
The InChIKey is ZPECEJYCNGSACG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3/c1-10-4-3-5-12(8-10)15(2)7-6-11(14)9-13/h3-5,8,11H,6-7,14H2,1-2H3.
What are the key properties of 2-amino-4-(N,3-dimethylanilino)butanenitrile?
2-amino-4-(N,3-dimethylanilino)butanenitrile has a molecular weight of 203.29 g/mol, XLogP of 1.67, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-(N,3-dimethylanilino)butanenitrile is sourced from PubChem (CID 63027364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).