C16H26N2O2 — CID 63053650
methyl 4-(N,3-dimethylanilino)-2-(propan-2-ylamino)butanoate (PubChem CID 63053650) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is methyl 4-(N,3-dimethylanilino)-2-(propan-2-ylamino)butanoate.
| Compound Name | methyl 4-(N,3-dimethylanilino)-2-(propan-2-ylamino)butanoate |
|---|---|
| PubChem CID | 63053650 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | methyl 4-(N,3-dimethylanilino)-2-(propan-2-ylamino)butanoate |
| SMILES | COC(=O)C(CCN(C)c1cccc(C)c1)NC(C)C |
| InChI | InChI=1S/C16H26N2O2/c1-12(2)17-15(16(19)20-5)9-10-18(4)14-8-6-7-13(3)11-14/h6-8,11-12,15,17H,9-10H2,1-5H3 |
| InChIKey | XGIHNRGKDNVYLB-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |