C11H16N2O — CID 83818168
1-amino-3-(N,3-dimethylanilino)propan-2-one (PubChem CID 83818168) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 1-amino-3-(N,3-dimethylanilino)propan-2-one.
| Compound Name | 1-amino-3-(N,3-dimethylanilino)propan-2-one |
|---|---|
| PubChem CID | 83818168 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 1-amino-3-(N,3-dimethylanilino)propan-2-one |
| SMILES | Cc1cccc(N(C)CC(=O)CN)c1 |
| InChI | InChI=1S/C11H16N2O/c1-9-4-3-5-10(6-9)13(2)8-11(14)7-12/h3-6H,7-8,12H2,1-2H3 |
| InChIKey | KXYZBBKYWAVXCH-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |