C16H19N3O — CID 63585084
2-[(N,3-dimethylanilino)methyl]benzohydrazide (PubChem CID 63585084) has the molecular formula C16H19N3O and a molecular weight of 269.35 g/mol. Its IUPAC name is 2-[(N,3-dimethylanilino)methyl]benzohydrazide.
| Compound Name | 2-[(N,3-dimethylanilino)methyl]benzohydrazide |
|---|---|
| PubChem CID | 63585084 |
| Molecular Formula | C16H19N3O |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 2-[(N,3-dimethylanilino)methyl]benzohydrazide |
| SMILES | Cc1cccc(N(C)Cc2ccccc2C(=O)NN)c1 |
| InChI | InChI=1S/C16H19N3O/c1-12-6-5-8-14(10-12)19(2)11-13-7-3-4-9-15(13)16(20)18-17/h3-10H,11,17H2,1-2H3,(H,18,20) |
| InChIKey | TVYNHEIAZYJLMY-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|