C17H32N2 — CID 167711519
N,1-dimethyl-N-(3-methylphenyl)pyrrolidin-3-amine;ethane (PubChem CID 167711519) has the molecular formula C17H32N2 and a molecular weight of 264.46 g/mol. Its IUPAC name is N,1-dimethyl-N-(3-methylphenyl)pyrrolidin-3-amine;ethane.
| Compound Name | N,1-dimethyl-N-(3-methylphenyl)pyrrolidin-3-amine;ethane |
|---|---|
| PubChem CID | 167711519 |
| Molecular Formula | C17H32N2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.26 |
| IUPAC Name | N,1-dimethyl-N-(3-methylphenyl)pyrrolidin-3-amine;ethane |
| SMILES | CC.CC.Cc1cccc(N(C)C2CCN(C)C2)c1 |
| InChI | InChI=1S/C13H20N2.2C2H6/c1-11-5-4-6-12(9-11)15(3)13-7-8-14(2)10-13;2*1-2/h4-6,9,13H,7-8,10H2,1-3H3;2*1-2H3 |
| InChIKey | ZXFRBMHKRJFZCI-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |