C18H27N3O2 — CID 108507347
N'-ethyl-N-methyl-N'-(3-methylphenyl)-N-(1-methylpiperidin-4-yl)oxamide (PubChem CID 108507347) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is N'-ethyl-N-methyl-N'-(3-methylphenyl)-N-(1-methylpiperidin-4-yl)oxamide.
| Compound Name | N'-ethyl-N-methyl-N'-(3-methylphenyl)-N-(1-methylpiperidin-4-yl)oxamide |
|---|---|
| PubChem CID | 108507347 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | N'-ethyl-N-methyl-N'-(3-methylphenyl)-N-(1-methylpiperidin-4-yl)oxamide |
| SMILES | CCN(C(=O)C(=O)N(C)C1CCN(C)CC1)c1cccc(C)c1 |
| InChI | InChI=1S/C18H27N3O2/c1-5-21(16-8-6-7-14(2)13-16)18(23)17(22)20(4)15-9-11-19(3)12-10-15/h6-8,13,15H,5,9-12H2,1-4H3 |
| InChIKey | TWUXSUBQJMWLLZ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|