C18H26N2O2 — CID 108520654
2-(3,5-dimethylpiperidin-1-yl)-N-ethyl-N-(3-methylphenyl)-2-oxoacetamide (PubChem CID 108520654) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 2-(3,5-dimethylpiperidin-1-yl)-N-ethyl-N-(3-methylphenyl)-2-oxoacetamide.
| Compound Name | 2-(3,5-dimethylpiperidin-1-yl)-N-ethyl-N-(3-methylphenyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 108520654 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | 2-(3,5-dimethylpiperidin-1-yl)-N-ethyl-N-(3-methylphenyl)-2-oxoacetamide |
| SMILES | CCN(C(=O)C(=O)N1CC(C)CC(C)C1)c1cccc(C)c1 |
| InChI | InChI=1S/C18H26N2O2/c1-5-20(16-8-6-7-13(2)10-16)18(22)17(21)19-11-14(3)9-15(4)12-19/h6-8,10,14-15H,5,9,11-12H2,1-4H3 |
| InChIKey | ILKOLVOJLZFONP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|