C16H21F3N2O2 — CID 95339702
1-[[(3R)-oxolan-3-yl]methyl]-3-[2-[3-(trifluoromethyl)phenyl]propan-2-yl]urea (PubChem CID 95339702) has the molecular formula C16H21F3N2O2 and a molecular weight of 330.35 g/mol. Its IUPAC name is 1-[[(3R)-oxolan-3-yl]methyl]-3-[2-[3-(trifluoromethyl)phenyl]propan-2-yl]urea.
| Compound Name | 1-[[(3R)-oxolan-3-yl]methyl]-3-[2-[3-(trifluoromethyl)phenyl]propan-2-yl]urea |
|---|---|
| PubChem CID | 95339702 |
| Molecular Formula | C16H21F3N2O2 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 1-[[(3R)-oxolan-3-yl]methyl]-3-[2-[3-(trifluoromethyl)phenyl]propan-2-yl]urea |
| SMILES | CC(C)(NC(=O)NC[C@H]1CCOC1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H21F3N2O2/c1-15(2,12-4-3-5-13(8-12)16(17,18)19)21-14(22)20-9-11-6-7-23-10-11/h3-5,8,11H,6-7,9-10H2,1-2H3,(H2,20,21,22)/t11-/m1/s1 |
| InChIKey | GVUNZZKGNVIWCT-LLVKDONJSA-N |
| XLogP | 3.28 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |