C13H16N2O4 — CID 55118965
3-(oxolan-3-ylmethylcarbamoylamino)benzoic acid (PubChem CID 55118965) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is 3-(oxolan-3-ylmethylcarbamoylamino)benzoic acid.
| Compound Name | 3-(oxolan-3-ylmethylcarbamoylamino)benzoic acid |
|---|---|
| PubChem CID | 55118965 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 3-(oxolan-3-ylmethylcarbamoylamino)benzoic acid |
| SMILES | O=C(NCC1CCOC1)Nc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C13H16N2O4/c16-12(17)10-2-1-3-11(6-10)15-13(18)14-7-9-4-5-19-8-9/h1-3,6,9H,4-5,7-8H2,(H,16,17)(H2,14,15,18) |
| InChIKey | FSDGTWQKSSPEMO-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |