C23H23N3O4 — CID 177379567
3-[7-(oxan-4-ylmethylcarbamoylamino)quinolin-3-yl]benzoic acid (PubChem CID 177379567) has the molecular formula C23H23N3O4 and a molecular weight of 405.45 g/mol. Its IUPAC name is 3-[7-(oxan-4-ylmethylcarbamoylamino)quinolin-3-yl]benzoic acid.
| Compound Name | 3-[7-(oxan-4-ylmethylcarbamoylamino)quinolin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 177379567 |
| Molecular Formula | C23H23N3O4 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 3-[7-(oxan-4-ylmethylcarbamoylamino)quinolin-3-yl]benzoic acid |
| SMILES | O=C(NCC1CCOCC1)Nc1ccc2cc(-c3cccc(C(=O)O)c3)cnc2c1 |
| InChI | InChI=1S/C23H23N3O4/c27-22(28)18-3-1-2-16(10-18)19-11-17-4-5-20(12-21(17)24-14-19)26-23(29)25-13-15-6-8-30-9-7-15/h1-5,10-12,14-15H,6-9,13H2,(H,27,28)(H2,25,26,29) |
| InChIKey | SGPRLIKHJCTCDM-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |