C22H27N3O3 — CID 72889045
4-(oxan-4-ylmethylcarbamoylamino)-N-(2-phenylethyl)benzamide (PubChem CID 72889045) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is 4-(oxan-4-ylmethylcarbamoylamino)-N-(2-phenylethyl)benzamide.
| Compound Name | 4-(oxan-4-ylmethylcarbamoylamino)-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 72889045 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 4-(oxan-4-ylmethylcarbamoylamino)-N-(2-phenylethyl)benzamide |
| SMILES | O=C(NCC1CCOCC1)Nc1ccc(C(=O)NCCc2ccccc2)cc1 |
| InChI | InChI=1S/C22H27N3O3/c26-21(23-13-10-17-4-2-1-3-5-17)19-6-8-20(9-7-19)25-22(27)24-16-18-11-14-28-15-12-18/h1-9,18H,10-16H2,(H,23,26)(H2,24,25,27) |
| InChIKey | BWAUQNKMEVHSFZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |