C19H22F3NO — CID 19770012
(2E,4E)-N-(2-methylpropyl)-5-[2-[3-(trifluoromethyl)phenyl]cyclopropyl]penta-2,4-dienamide (PubChem CID 19770012) has the molecular formula C19H22F3NO and a molecular weight of 337.39 g/mol. Its IUPAC name is (2E,4E)-N-(2-methylpropyl)-5-[2-[3-(trifluoromethyl)phenyl]cyclopropyl]penta-2,4-dienamide.
| Compound Name | (2E,4E)-N-(2-methylpropyl)-5-[2-[3-(trifluoromethyl)phenyl]cyclopropyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 19770012 |
| Molecular Formula | C19H22F3NO |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | (2E,4E)-N-(2-methylpropyl)-5-[2-[3-(trifluoromethyl)phenyl]cyclopropyl]penta-2,4-dienamide |
| SMILES | CC(C)CNC(=O)/C=C/C=C/C1CC1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H22F3NO/c1-13(2)12-23-18(24)9-4-3-6-15-11-17(15)14-7-5-8-16(10-14)19(20,21)22/h3-10,13,15,17H,11-12H2,1-2H3,(H,23,24)/b6-3+,9-4+ |
| InChIKey | SKHXGJGKVDQSRE-PLPQCDBPSA-N |
| XLogP | 4.69 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|