C20H23ClF3NO — CID 54553975
5-[(1S,2R)-2-[4-chloro-3-(trifluoromethyl)phenyl]cyclopropyl]-3-methyl-N-(2-methylpropyl)penta-2,4-dienamide (PubChem CID 54553975) has the molecular formula C20H23ClF3NO and a molecular weight of 385.86 g/mol. Its IUPAC name is 5-[(1S,2R)-2-[4-chloro-3-(trifluoromethyl)phenyl]cyclopropyl]-3-methyl-N-(2-methylpropyl)penta-2,4-dienamide.
| Compound Name | 5-[(1S,2R)-2-[4-chloro-3-(trifluoromethyl)phenyl]cyclopropyl]-3-methyl-N-(2-methylpropyl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 54553975 |
| Molecular Formula | C20H23ClF3NO |
| Molecular Weight | 385.86 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 5-[(1S,2R)-2-[4-chloro-3-(trifluoromethyl)phenyl]cyclopropyl]-3-methyl-N-(2-methylpropyl)penta-2,4-dienamide |
| SMILES | CC(C=C[C@@H]1C[C@H]1c1ccc(Cl)c(C(F)(F)F)c1)=CC(=O)NCC(C)C |
| InChI | InChI=1S/C20H23ClF3NO/c1-12(2)11-25-19(26)8-13(3)4-5-14-9-16(14)15-6-7-18(21)17(10-15)20(22,23)24/h4-8,10,12,14,16H,9,11H2,1-3H3,(H,25,26)/t14-,16-/m1/s1 |
| InChIKey | ZLWKMVVMUUWNDE-GDBMZVCRSA-N |
| XLogP | 5.74 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.86 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|