C15H17ClF3NO2 — CID 60618990
(E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-(4-methoxybutan-2-yl)prop-2-enamide (PubChem CID 60618990) has the molecular formula C15H17ClF3NO2 and a molecular weight of 335.75 g/mol. Its IUPAC name is (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-(4-methoxybutan-2-yl)prop-2-enamide.
| Compound Name | (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-(4-methoxybutan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 60618990 |
| Molecular Formula | C15H17ClF3NO2 |
| Molecular Weight | 335.75 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-(4-methoxybutan-2-yl)prop-2-enamide |
| SMILES | COCCC(C)NC(=O)/C=C/c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H17ClF3NO2/c1-10(7-8-22-2)20-14(21)6-4-11-3-5-13(16)12(9-11)15(17,18)19/h3-6,9-10H,7-8H2,1-2H3,(H,20,21)/b6-4+ |
| InChIKey | LOLOUGKKQXHYMW-GQCTYLIASA-N |
| XLogP | 3.91 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.75 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|