C14H15ClF3NO2 — CID 111429005
3-[4-chloro-3-(trifluoromethyl)phenyl]-N-(3-hydroxybutyl)prop-2-enamide (PubChem CID 111429005) has the molecular formula C14H15ClF3NO2 and a molecular weight of 321.73 g/mol. Its IUPAC name is 3-[4-chloro-3-(trifluoromethyl)phenyl]-N-(3-hydroxybutyl)prop-2-enamide.
| Compound Name | 3-[4-chloro-3-(trifluoromethyl)phenyl]-N-(3-hydroxybutyl)prop-2-enamide |
|---|---|
| PubChem CID | 111429005 |
| Molecular Formula | C14H15ClF3NO2 |
| Molecular Weight | 321.73 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 3-[4-chloro-3-(trifluoromethyl)phenyl]-N-(3-hydroxybutyl)prop-2-enamide |
| SMILES | CC(O)CCNC(=O)C=Cc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H15ClF3NO2/c1-9(20)6-7-19-13(21)5-3-10-2-4-12(15)11(8-10)14(16,17)18/h2-5,8-9,20H,6-7H2,1H3,(H,19,21) |
| InChIKey | MHADGLLYRKGUFT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.73 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|