C17H11ClF5NO — CID 123973637
N-[[4-chloro-3-(trifluoromethyl)phenyl]methyl]-3-(3,4-difluorophenyl)prop-2-enamide (PubChem CID 123973637) has the molecular formula C17H11ClF5NO and a molecular weight of 375.72 g/mol. Its IUPAC name is N-[[4-chloro-3-(trifluoromethyl)phenyl]methyl]-3-(3,4-difluorophenyl)prop-2-enamide.
| Compound Name | N-[[4-chloro-3-(trifluoromethyl)phenyl]methyl]-3-(3,4-difluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 123973637 |
| Molecular Formula | C17H11ClF5NO |
| Molecular Weight | 375.72 g/mol |
| Exact Mass | 375.04 |
| IUPAC Name | N-[[4-chloro-3-(trifluoromethyl)phenyl]methyl]-3-(3,4-difluorophenyl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(F)c(F)c1)NCc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H11ClF5NO/c18-13-4-1-11(7-12(13)17(21,22)23)9-24-16(25)6-3-10-2-5-14(19)15(20)8-10/h1-8H,9H2,(H,24,25) |
| InChIKey | QNKMQWIBQAUYAG-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.72 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|