C13H11Cl2FO — CID 19769958
(E)-4-[2-(3,4-dichlorophenyl)cyclopropyl]-3-fluorobut-3-en-2-one (PubChem CID 19769958) has the molecular formula C13H11Cl2FO and a molecular weight of 273.13 g/mol. Its IUPAC name is (E)-4-[2-(3,4-dichlorophenyl)cyclopropyl]-3-fluorobut-3-en-2-one.
| Compound Name | (E)-4-[2-(3,4-dichlorophenyl)cyclopropyl]-3-fluorobut-3-en-2-one |
|---|---|
| PubChem CID | 19769958 |
| Molecular Formula | C13H11Cl2FO |
| Molecular Weight | 273.13 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | (E)-4-[2-(3,4-dichlorophenyl)cyclopropyl]-3-fluorobut-3-en-2-one |
| SMILES | CC(=O)/C(F)=C\C1CC1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H11Cl2FO/c1-7(17)13(16)6-9-4-10(9)8-2-3-11(14)12(15)5-8/h2-3,5-6,9-10H,4H2,1H3/b13-6+ |
| InChIKey | QVAOUCRUBKRPRN-AWNIVKPZSA-N |
| XLogP | 4.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.13 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|