C19H22Cl2FNO — CID 142625195
(2E,4Z)-5-[(1R,2R)-2-(3,4-dichlorophenyl)cyclopropyl]-4-fluoro-N-(3-methylbutan-2-yl)penta-2,4-dienamide (PubChem CID 142625195) has the molecular formula C19H22Cl2FNO and a molecular weight of 370.30 g/mol. Its IUPAC name is (2E,4Z)-5-[(1R,2R)-2-(3,4-dichlorophenyl)cyclopropyl]-4-fluoro-N-(3-methylbutan-2-yl)penta-2,4-dienamide.
| Compound Name | (2E,4Z)-5-[(1R,2R)-2-(3,4-dichlorophenyl)cyclopropyl]-4-fluoro-N-(3-methylbutan-2-yl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 142625195 |
| Molecular Formula | C19H22Cl2FNO |
| Molecular Weight | 370.30 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | (2E,4Z)-5-[(1R,2R)-2-(3,4-dichlorophenyl)cyclopropyl]-4-fluoro-N-(3-methylbutan-2-yl)penta-2,4-dienamide |
| SMILES | CC(C)C(C)NC(=O)/C=C/C(F)=C/[C@@H]1C[C@H]1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H22Cl2FNO/c1-11(2)12(3)23-19(24)7-5-15(22)8-14-9-16(14)13-4-6-17(20)18(21)10-13/h4-8,10-12,14,16H,9H2,1-3H3,(H,23,24)/b7-5+,15-8-/t12?,14-,16+/m1/s1 |
| InChIKey | YUVFUKCVQFHWDC-DMDGLXEISA-N |
| XLogP | 5.67 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.30 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|