C11H12Cl2O — CID 95002839
(1S)-1-[(1R,2S)-2-(3,4-dichlorophenyl)cyclopropyl]ethanol (PubChem CID 95002839) has the molecular formula C11H12Cl2O and a molecular weight of 231.12 g/mol. Its IUPAC name is (1S)-1-[(1R,2S)-2-(3,4-dichlorophenyl)cyclopropyl]ethanol.
| Compound Name | (1S)-1-[(1R,2S)-2-(3,4-dichlorophenyl)cyclopropyl]ethanol |
|---|---|
| PubChem CID | 95002839 |
| Molecular Formula | C11H12Cl2O |
| Molecular Weight | 231.12 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | (1S)-1-[(1R,2S)-2-(3,4-dichlorophenyl)cyclopropyl]ethanol |
| SMILES | C[C@H](O)[C@@H]1C[C@@H]1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H12Cl2O/c1-6(14)8-5-9(8)7-2-3-10(12)11(13)4-7/h2-4,6,8-9,14H,5H2,1H3/t6-,8-,9+/m0/s1 |
| InChIKey | NIYFAYJPNHXUHR-CNUIFLNQSA-N |
| XLogP | 3.48 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.12 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |