C13H19NO — CID 95002836
(1R)-1-[(1R,2S)-2-[4-(dimethylamino)phenyl]cyclopropyl]ethanol (PubChem CID 95002836) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is (1R)-1-[(1R,2S)-2-[4-(dimethylamino)phenyl]cyclopropyl]ethanol.
| Compound Name | (1R)-1-[(1R,2S)-2-[4-(dimethylamino)phenyl]cyclopropyl]ethanol |
|---|---|
| PubChem CID | 95002836 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | (1R)-1-[(1R,2S)-2-[4-(dimethylamino)phenyl]cyclopropyl]ethanol |
| SMILES | C[C@@H](O)[C@@H]1C[C@@H]1c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C13H19NO/c1-9(15)12-8-13(12)10-4-6-11(7-5-10)14(2)3/h4-7,9,12-13,15H,8H2,1-3H3/t9-,12+,13-/m1/s1 |
| InChIKey | NOLYNJCKOXZVCZ-JIMOISOXSA-N |
| XLogP | 2.24 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|