C18H22Cl2O3 — CID 102065753
methyl (1S,2R,3R,5S,6S)-3-(3,4-dichlorophenyl)-6-methoxy-8-methylbicyclo[3.2.1]octane-2-carboxylate (PubChem CID 102065753) has the molecular formula C18H22Cl2O3 and a molecular weight of 357.28 g/mol. Its IUPAC name is methyl (1S,2R,3R,5S,6S)-3-(3,4-dichlorophenyl)-6-methoxy-8-methylbicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | methyl (1S,2R,3R,5S,6S)-3-(3,4-dichlorophenyl)-6-methoxy-8-methylbicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 102065753 |
| Molecular Formula | C18H22Cl2O3 |
| Molecular Weight | 357.28 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | methyl (1S,2R,3R,5S,6S)-3-(3,4-dichlorophenyl)-6-methoxy-8-methylbicyclo[3.2.1]octane-2-carboxylate |
| SMILES | COC(=O)[C@H]1[C@H](c2ccc(Cl)c(Cl)c2)C[C@H]2C(C)[C@@H]1C[C@@H]2OC |
| InChI | InChI=1S/C18H22Cl2O3/c1-9-11-7-13(10-4-5-14(19)15(20)6-10)17(18(21)23-3)12(9)8-16(11)22-2/h4-6,9,11-13,16-17H,7-8H2,1-3H3/t9?,11-,12-,13-,16-,17+/m0/s1 |
| InChIKey | ZZFQVRGIADSDKU-OYEAXBOGSA-N |
| XLogP | 4.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.28 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |