C17H21Cl2NO4 — CID 12042403
methyl (2S)-3-(3,4-dichlorophenyl)-7-(methoxymethoxy)-8-azabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 12042403) has the molecular formula C17H21Cl2NO4 and a molecular weight of 374.26 g/mol. Its IUPAC name is methyl (2S)-3-(3,4-dichlorophenyl)-7-(methoxymethoxy)-8-azabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | methyl (2S)-3-(3,4-dichlorophenyl)-7-(methoxymethoxy)-8-azabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 12042403 |
| Molecular Formula | C17H21Cl2NO4 |
| Molecular Weight | 374.26 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | methyl (2S)-3-(3,4-dichlorophenyl)-7-(methoxymethoxy)-8-azabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | COCOC1CC2CC(c3ccc(Cl)c(Cl)c3)[C@H](C(=O)OC)C1N2 |
| InChI | InChI=1S/C17H21Cl2NO4/c1-22-8-24-14-7-10-6-11(9-3-4-12(18)13(19)5-9)15(16(14)20-10)17(21)23-2/h3-5,10-11,14-16,20H,6-8H2,1-2H3/t10?,11?,14?,15-,16?/m0/s1 |
| InChIKey | UPCCPGZGWJLBSR-GNAWKYBMSA-N |
| XLogP | 2.99 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.26 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|