C17H22Cl2N2O2 — CID 87680125
(3R,4S,5S)-3-(3,4-dichlorophenyl)-4-(C-ethyl-N-methoxycarbonimidoyl)-8-azabicyclo[3.2.1]octan-6-ol (PubChem CID 87680125) has the molecular formula C17H22Cl2N2O2 and a molecular weight of 357.28 g/mol. Its IUPAC name is (3R,4S,5S)-3-(3,4-dichlorophenyl)-4-(C-ethyl-N-methoxycarbonimidoyl)-8-azabicyclo[3.2.1]octan-6-ol.
| Compound Name | (3R,4S,5S)-3-(3,4-dichlorophenyl)-4-(C-ethyl-N-methoxycarbonimidoyl)-8-azabicyclo[3.2.1]octan-6-ol |
|---|---|
| PubChem CID | 87680125 |
| Molecular Formula | C17H22Cl2N2O2 |
| Molecular Weight | 357.28 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | (3R,4S,5S)-3-(3,4-dichlorophenyl)-4-(C-ethyl-N-methoxycarbonimidoyl)-8-azabicyclo[3.2.1]octan-6-ol |
| SMILES | CCC(=NOC)[C@@H]1[C@@H]2NC(CC2O)C[C@H]1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H22Cl2N2O2/c1-3-14(21-23-2)16-11(7-10-8-15(22)17(16)20-10)9-4-5-12(18)13(19)6-9/h4-6,10-11,15-17,20,22H,3,7-8H2,1-2H3/t10?,11-,15?,16+,17+/m0/s1 |
| InChIKey | YIAKKNVAWHUTHB-AXLFNNHTSA-N |
| XLogP | 3.60 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.28 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|