C17H22FNO3 — CID 87680531
(3R,4R,5R)-4-(C-ethyl-N-methoxycarbonimidoyl)-3-(4-fluorophenyl)-8-oxabicyclo[3.2.1]octan-6-ol (PubChem CID 87680531) has the molecular formula C17H22FNO3 and a molecular weight of 307.37 g/mol. Its IUPAC name is (3R,4R,5R)-4-(C-ethyl-N-methoxycarbonimidoyl)-3-(4-fluorophenyl)-8-oxabicyclo[3.2.1]octan-6-ol.
| Compound Name | (3R,4R,5R)-4-(C-ethyl-N-methoxycarbonimidoyl)-3-(4-fluorophenyl)-8-oxabicyclo[3.2.1]octan-6-ol |
|---|---|
| PubChem CID | 87680531 |
| Molecular Formula | C17H22FNO3 |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | (3R,4R,5R)-4-(C-ethyl-N-methoxycarbonimidoyl)-3-(4-fluorophenyl)-8-oxabicyclo[3.2.1]octan-6-ol |
| SMILES | CCC(=NOC)[C@H]1[C@H](c2ccc(F)cc2)CC2CC(O)[C@@H]1O2 |
| InChI | InChI=1S/C17H22FNO3/c1-3-14(19-21-2)16-13(10-4-6-11(18)7-5-10)8-12-9-15(20)17(16)22-12/h4-7,12-13,15-17,20H,3,8-9H2,1-2H3/t12?,13-,15?,16+,17-/m0/s1 |
| InChIKey | RQGJQYCOSIOAAL-XMVAWCSOSA-N |
| XLogP | 2.86 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|