C17H21Cl2NO2S — CID 87683783
(3R,4R,5S)-3-(3,4-dichlorophenyl)-4-(C-ethyl-N-methoxycarbonimidoyl)-8-thiabicyclo[3.2.1]octan-6-ol (PubChem CID 87683783) has the molecular formula C17H21Cl2NO2S and a molecular weight of 374.33 g/mol. Its IUPAC name is (3R,4R,5S)-3-(3,4-dichlorophenyl)-4-(C-ethyl-N-methoxycarbonimidoyl)-8-thiabicyclo[3.2.1]octan-6-ol.
| Compound Name | (3R,4R,5S)-3-(3,4-dichlorophenyl)-4-(C-ethyl-N-methoxycarbonimidoyl)-8-thiabicyclo[3.2.1]octan-6-ol |
|---|---|
| PubChem CID | 87683783 |
| Molecular Formula | C17H21Cl2NO2S |
| Molecular Weight | 374.33 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | (3R,4R,5S)-3-(3,4-dichlorophenyl)-4-(C-ethyl-N-methoxycarbonimidoyl)-8-thiabicyclo[3.2.1]octan-6-ol |
| SMILES | CCC(=NOC)[C@@H]1[C@@H]2SC(CC2O)C[C@H]1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H21Cl2NO2S/c1-3-14(20-22-2)16-11(7-10-8-15(21)17(16)23-10)9-4-5-12(18)13(19)6-9/h4-6,10-11,15-17,21H,3,7-8H2,1-2H3/t10?,11-,15?,16+,17+/m0/s1 |
| InChIKey | KVESRUHOXDZSND-AXLFNNHTSA-N |
| XLogP | 4.74 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.33 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|