C18H21Cl2NO2 — CID 87682045
(5S)-3-(3,4-dichlorophenyl)-4-(C-ethyl-N-methoxycarbonimidoyl)bicyclo[3.2.1]oct-3-en-6-ol (PubChem CID 87682045) has the molecular formula C18H21Cl2NO2 and a molecular weight of 354.28 g/mol. Its IUPAC name is (5S)-3-(3,4-dichlorophenyl)-4-(C-ethyl-N-methoxycarbonimidoyl)bicyclo[3.2.1]oct-3-en-6-ol.
| Compound Name | (5S)-3-(3,4-dichlorophenyl)-4-(C-ethyl-N-methoxycarbonimidoyl)bicyclo[3.2.1]oct-3-en-6-ol |
|---|---|
| PubChem CID | 87682045 |
| Molecular Formula | C18H21Cl2NO2 |
| Molecular Weight | 354.28 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | (5S)-3-(3,4-dichlorophenyl)-4-(C-ethyl-N-methoxycarbonimidoyl)bicyclo[3.2.1]oct-3-en-6-ol |
| SMILES | CCC(=NOC)C1=C(c2ccc(Cl)c(Cl)c2)CC2CC(O)[C@H]1C2 |
| InChI | InChI=1S/C18H21Cl2NO2/c1-3-16(21-23-2)18-12(6-10-7-13(18)17(22)8-10)11-4-5-14(19)15(20)9-11/h4-5,9-10,13,17,22H,3,6-8H2,1-2H3/t10?,13-,17?/m1/s1 |
| InChIKey | DHEMEXBSLGIJCK-OPEGHZNSSA-N |
| XLogP | 4.95 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.28 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|