C17H20Cl2O3 — CID 102065744
methyl (1S,2S,3S,5R,7R)-3-(3,4-dichlorophenyl)-7-hydroxy-8-methylbicyclo[3.2.1]octane-2-carboxylate (PubChem CID 102065744) has the molecular formula C17H20Cl2O3 and a molecular weight of 343.25 g/mol. Its IUPAC name is methyl (1S,2S,3S,5R,7R)-3-(3,4-dichlorophenyl)-7-hydroxy-8-methylbicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | methyl (1S,2S,3S,5R,7R)-3-(3,4-dichlorophenyl)-7-hydroxy-8-methylbicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 102065744 |
| Molecular Formula | C17H20Cl2O3 |
| Molecular Weight | 343.25 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | methyl (1S,2S,3S,5R,7R)-3-(3,4-dichlorophenyl)-7-hydroxy-8-methylbicyclo[3.2.1]octane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H]2C(C)[C@@H](C[C@H]2O)C[C@@H]1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H20Cl2O3/c1-8-10-5-11(9-3-4-12(18)13(19)6-9)16(17(21)22-2)15(8)14(20)7-10/h3-4,6,8,10-11,14-16,20H,5,7H2,1-2H3/t8?,10-,11-,14-,15-,16+/m1/s1 |
| InChIKey | PECJMPCTSKKYPO-JUNOULOASA-N |
| XLogP | 3.90 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.25 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |