C13H20N2O5 — CID 146363659
(E,2S)-2-(methoxycarbonylamino)-7-oxo-7-pyrrolidin-1-ylhept-5-enoic acid (PubChem CID 146363659) has the molecular formula C13H20N2O5 and a molecular weight of 284.31 g/mol. Its IUPAC name is (E,2S)-2-(methoxycarbonylamino)-7-oxo-7-pyrrolidin-1-ylhept-5-enoic acid.
| Compound Name | (E,2S)-2-(methoxycarbonylamino)-7-oxo-7-pyrrolidin-1-ylhept-5-enoic acid |
|---|---|
| PubChem CID | 146363659 |
| Molecular Formula | C13H20N2O5 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | (E,2S)-2-(methoxycarbonylamino)-7-oxo-7-pyrrolidin-1-ylhept-5-enoic acid |
| SMILES | COC(=O)N[C@@H](CC/C=C/C(=O)N1CCCC1)C(=O)O |
| InChI | InChI=1S/C13H20N2O5/c1-20-13(19)14-10(12(17)18)6-2-3-7-11(16)15-8-4-5-9-15/h3,7,10H,2,4-6,8-9H2,1H3,(H,14,19)(H,17,18)/b7-3+/t10-/m0/s1 |
| InChIKey | VDPKQGPAPRETCC-HTZNOQTFSA-N |
| XLogP | 0.75 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|