C16H27N3O5 — CID 120703250
4-methoxy-2-[[1-(pyrrolidine-1-carbonyl)piperidine-4-carbonyl]amino]butanoic acid (PubChem CID 120703250) has the molecular formula C16H27N3O5 and a molecular weight of 341.41 g/mol. Its IUPAC name is 4-methoxy-2-[[1-(pyrrolidine-1-carbonyl)piperidine-4-carbonyl]amino]butanoic acid.
| Compound Name | 4-methoxy-2-[[1-(pyrrolidine-1-carbonyl)piperidine-4-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 120703250 |
| Molecular Formula | C16H27N3O5 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | 4-methoxy-2-[[1-(pyrrolidine-1-carbonyl)piperidine-4-carbonyl]amino]butanoic acid |
| SMILES | COCCC(NC(=O)C1CCN(C(=O)N2CCCC2)CC1)C(=O)O |
| InChI | InChI=1S/C16H27N3O5/c1-24-11-6-13(15(21)22)17-14(20)12-4-9-19(10-5-12)16(23)18-7-2-3-8-18/h12-13H,2-11H2,1H3,(H,17,20)(H,21,22) |
| InChIKey | XHBBIDBYBAAZIY-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |