C15H28N2O6S — CID 120702923
2-[(1-butylsulfonylpiperidine-4-carbonyl)amino]-4-methoxybutanoic acid (PubChem CID 120702923) has the molecular formula C15H28N2O6S and a molecular weight of 364.46 g/mol. Its IUPAC name is 2-[(1-butylsulfonylpiperidine-4-carbonyl)amino]-4-methoxybutanoic acid.
| Compound Name | 2-[(1-butylsulfonylpiperidine-4-carbonyl)amino]-4-methoxybutanoic acid |
|---|---|
| PubChem CID | 120702923 |
| Molecular Formula | C15H28N2O6S |
| Molecular Weight | 364.46 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 2-[(1-butylsulfonylpiperidine-4-carbonyl)amino]-4-methoxybutanoic acid |
| SMILES | CCCCS(=O)(=O)N1CCC(C(=O)NC(CCOC)C(=O)O)CC1 |
| InChI | InChI=1S/C15H28N2O6S/c1-3-4-11-24(21,22)17-8-5-12(6-9-17)14(18)16-13(15(19)20)7-10-23-2/h12-13H,3-11H2,1-2H3,(H,16,18)(H,19,20) |
| InChIKey | CVOUWWUTORFMKS-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.46 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |