C9H11N3O — CID 166914330
(E)-N,N-dimethyl-3-pyrimidin-2-ylprop-2-enamide (PubChem CID 166914330) has the molecular formula C9H11N3O and a molecular weight of 177.21 g/mol. Its IUPAC name is (E)-N,N-dimethyl-3-pyrimidin-2-ylprop-2-enamide.
| Compound Name | (E)-N,N-dimethyl-3-pyrimidin-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 166914330 |
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | (E)-N,N-dimethyl-3-pyrimidin-2-ylprop-2-enamide |
| SMILES | CN(C)C(=O)/C=C/c1ncccn1 |
| InChI | InChI=1S/C9H11N3O/c1-12(2)9(13)5-4-8-10-6-3-7-11-8/h3-7H,1-2H3/b5-4+ |
| InChIKey | DXMVCFYZEFJCQI-SNAWJCMRSA-N |
| XLogP | 0.58 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|