C21H18FN3O2 — CID 68527431
3-[4-[4-(4-fluorophenoxy)phenyl]pyrimidin-2-yl]-N,N-dimethylprop-2-enamide (PubChem CID 68527431) has the molecular formula C21H18FN3O2 and a molecular weight of 363.39 g/mol. Its IUPAC name is 3-[4-[4-(4-fluorophenoxy)phenyl]pyrimidin-2-yl]-N,N-dimethylprop-2-enamide.
| Compound Name | 3-[4-[4-(4-fluorophenoxy)phenyl]pyrimidin-2-yl]-N,N-dimethylprop-2-enamide |
|---|---|
| PubChem CID | 68527431 |
| Molecular Formula | C21H18FN3O2 |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 3-[4-[4-(4-fluorophenoxy)phenyl]pyrimidin-2-yl]-N,N-dimethylprop-2-enamide |
| SMILES | CN(C)C(=O)C=Cc1nccc(-c2ccc(Oc3ccc(F)cc3)cc2)n1 |
| InChI | InChI=1S/C21H18FN3O2/c1-25(2)21(26)12-11-20-23-14-13-19(24-20)15-3-7-17(8-4-15)27-18-9-5-16(22)6-10-18/h3-14H,1-2H3 |
| InChIKey | TUHFJSJCHAMLKE-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|