C13H8F2N2O2 — CID 116901718
(E)-3-[4-(3,4-difluorophenyl)pyrimidin-2-yl]prop-2-enoic acid (PubChem CID 116901718) has the molecular formula C13H8F2N2O2 and a molecular weight of 262.22 g/mol. Its IUPAC name is (E)-3-[4-(3,4-difluorophenyl)pyrimidin-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-(3,4-difluorophenyl)pyrimidin-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 116901718 |
| Molecular Formula | C13H8F2N2O2 |
| Molecular Weight | 262.22 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | (E)-3-[4-(3,4-difluorophenyl)pyrimidin-2-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1nccc(-c2ccc(F)c(F)c2)n1 |
| InChI | InChI=1S/C13H8F2N2O2/c14-9-2-1-8(7-10(9)15)11-5-6-16-12(17-11)3-4-13(18)19/h1-7H,(H,18,19)/b4-3+ |
| InChIKey | MOFINCUCVSOQLU-ONEGZZNKSA-N |
| XLogP | 2.52 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.22 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|