C14H12F2N2O — CID 116901657
4-[4-(3,4-difluorophenyl)pyrimidin-2-yl]butan-2-one (PubChem CID 116901657) has the molecular formula C14H12F2N2O and a molecular weight of 262.26 g/mol. Its IUPAC name is 4-[4-(3,4-difluorophenyl)pyrimidin-2-yl]butan-2-one.
| Compound Name | 4-[4-(3,4-difluorophenyl)pyrimidin-2-yl]butan-2-one |
|---|---|
| PubChem CID | 116901657 |
| Molecular Formula | C14H12F2N2O |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 4-[4-(3,4-difluorophenyl)pyrimidin-2-yl]butan-2-one |
| SMILES | CC(=O)CCc1nccc(-c2ccc(F)c(F)c2)n1 |
| InChI | InChI=1S/C14H12F2N2O/c1-9(19)2-5-14-17-7-6-13(18-14)10-3-4-11(15)12(16)8-10/h3-4,6-8H,2,5H2,1H3 |
| InChIKey | QQILQPJFOWWBSI-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |