C25H28FIN4O2 — CID 71565568
4-[4-(4-fluorophenoxy)phenyl]-N-[2-(1-methylpiperidin-1-ium-1-yl)ethyl]pyrimidine-2-carboxamide iodide (PubChem CID 71565568) has the molecular formula C25H28FIN4O2 and a molecular weight of 562.43 g/mol. Its IUPAC name is 4-[4-(4-fluorophenoxy)phenyl]-N-[2-(1-methylpiperidin-1-ium-1-yl)ethyl]pyrimidine-2-carboxamide iodide.
| Compound Name | 4-[4-(4-fluorophenoxy)phenyl]-N-[2-(1-methylpiperidin-1-ium-1-yl)ethyl]pyrimidine-2-carboxamide iodide |
|---|---|
| PubChem CID | 71565568 |
| Molecular Formula | C25H28FIN4O2 |
| Molecular Weight | 562.43 g/mol |
| Exact Mass | 562.12 |
| IUPAC Name | 4-[4-(4-fluorophenoxy)phenyl]-N-[2-(1-methylpiperidin-1-ium-1-yl)ethyl]pyrimidine-2-carboxamide iodide |
| SMILES | C[N+]1(CCNC(=O)c2nccc(-c3ccc(Oc4ccc(F)cc4)cc3)n2)CCCCC1.[I-] |
| InChI | InChI=1S/C25H27FN4O2.HI/c1-30(16-3-2-4-17-30)18-15-28-25(31)24-27-14-13-23(29-24)19-5-9-21(10-6-19)32-22-11-7-20(26)8-12-22;/h5-14H,2-4,15-18H2,1H3;1H |
| InChIKey | HIPSBXVMMINHNP-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.43 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|