C28H27FN3O2+ — CID 71566411
[4-[[[2-[4-(4-fluorophenoxy)phenyl]pyridine-4-carbonyl]amino]methyl]phenyl]-trimethylazanium (PubChem CID 71566411) has the molecular formula C28H27FN3O2+ and a molecular weight of 456.54 g/mol. Its IUPAC name is [4-[[[2-[4-(4-fluorophenoxy)phenyl]pyridine-4-carbonyl]amino]methyl]phenyl]-trimethylazanium.
| Compound Name | [4-[[[2-[4-(4-fluorophenoxy)phenyl]pyridine-4-carbonyl]amino]methyl]phenyl]-trimethylazanium |
|---|---|
| PubChem CID | 71566411 |
| Molecular Formula | C28H27FN3O2+ |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | [4-[[[2-[4-(4-fluorophenoxy)phenyl]pyridine-4-carbonyl]amino]methyl]phenyl]-trimethylazanium |
| SMILES | C[N+](C)(C)c1ccc(CNC(=O)c2ccnc(-c3ccc(Oc4ccc(F)cc4)cc3)c2)cc1 |
| InChI | InChI=1S/C28H26FN3O2/c1-32(2,3)24-10-4-20(5-11-24)19-31-28(33)22-16-17-30-27(18-22)21-6-12-25(13-7-21)34-26-14-8-23(29)9-15-26/h4-18H,19H2,1-3H3/p+1 |
| InChIKey | SSAJIKHCFIYYJG-UHFFFAOYSA-O |
| XLogP | 5.81 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|