C24H27FIN3O2 — CID 71566252
2-[[2-[4-(4-fluorophenoxy)phenyl]-6-methylpyridine-4-carbonyl]amino]ethyl-trimethylazanium iodide (PubChem CID 71566252) has the molecular formula C24H27FIN3O2 and a molecular weight of 535.40 g/mol. Its IUPAC name is 2-[[2-[4-(4-fluorophenoxy)phenyl]-6-methylpyridine-4-carbonyl]amino]ethyl-trimethylazanium iodide.
| Compound Name | 2-[[2-[4-(4-fluorophenoxy)phenyl]-6-methylpyridine-4-carbonyl]amino]ethyl-trimethylazanium iodide |
|---|---|
| PubChem CID | 71566252 |
| Molecular Formula | C24H27FIN3O2 |
| Molecular Weight | 535.40 g/mol |
| Exact Mass | 535.11 |
| IUPAC Name | 2-[[2-[4-(4-fluorophenoxy)phenyl]-6-methylpyridine-4-carbonyl]amino]ethyl-trimethylazanium iodide |
| SMILES | Cc1cc(C(=O)NCC[N+](C)(C)C)cc(-c2ccc(Oc3ccc(F)cc3)cc2)n1.[I-] |
| InChI | InChI=1S/C24H26FN3O2.HI/c1-17-15-19(24(29)26-13-14-28(2,3)4)16-23(27-17)18-5-9-21(10-6-18)30-22-11-7-20(25)8-12-22;/h5-12,15-16H,13-14H2,1-4H3;1H |
| InChIKey | JXZSZIJCIKSGRI-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.40 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|