C22H18FN5O3 — CID 66806386
methyl 2-[5-[2-[4-(4-fluorophenoxy)phenyl]-6-methyl-4-pyridinyl]tetrazol-2-yl]acetate (PubChem CID 66806386) has the molecular formula C22H18FN5O3 and a molecular weight of 419.42 g/mol. Its IUPAC name is methyl 2-[5-[2-[4-(4-fluorophenoxy)phenyl]-6-methyl-4-pyridinyl]tetrazol-2-yl]acetate.
| Compound Name | methyl 2-[5-[2-[4-(4-fluorophenoxy)phenyl]-6-methyl-4-pyridinyl]tetrazol-2-yl]acetate |
|---|---|
| PubChem CID | 66806386 |
| Molecular Formula | C22H18FN5O3 |
| Molecular Weight | 419.42 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | methyl 2-[5-[2-[4-(4-fluorophenoxy)phenyl]-6-methyl-4-pyridinyl]tetrazol-2-yl]acetate |
| SMILES | COC(=O)Cn1nnc(-c2cc(C)nc(-c3ccc(Oc4ccc(F)cc4)cc3)c2)n1 |
| InChI | InChI=1S/C22H18FN5O3/c1-14-11-16(22-25-27-28(26-22)13-21(29)30-2)12-20(24-14)15-3-7-18(8-4-15)31-19-9-5-17(23)6-10-19/h3-12H,13H2,1-2H3 |
| InChIKey | OUNXRMJDPDEYLR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 92.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |