C26H29FN3O2+ — CID 71566105
2-[4-(4-fluorophenoxy)phenyl]-6-methyl-N-[2-(1-methylpyrrolidin-1-ium-1-yl)ethyl]pyridine-4-carboxamide (PubChem CID 71566105) has the molecular formula C26H29FN3O2+ and a molecular weight of 434.54 g/mol. Its IUPAC name is 2-[4-(4-fluorophenoxy)phenyl]-6-methyl-N-[2-(1-methylpyrrolidin-1-ium-1-yl)ethyl]pyridine-4-carboxamide.
| Compound Name | 2-[4-(4-fluorophenoxy)phenyl]-6-methyl-N-[2-(1-methylpyrrolidin-1-ium-1-yl)ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 71566105 |
| Molecular Formula | C26H29FN3O2+ |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | 2-[4-(4-fluorophenoxy)phenyl]-6-methyl-N-[2-(1-methylpyrrolidin-1-ium-1-yl)ethyl]pyridine-4-carboxamide |
| SMILES | Cc1cc(C(=O)NCC[N+]2(C)CCCC2)cc(-c2ccc(Oc3ccc(F)cc3)cc2)n1 |
| InChI | InChI=1S/C26H28FN3O2/c1-19-17-21(26(31)28-13-16-30(2)14-3-4-15-30)18-25(29-19)20-5-9-23(10-6-20)32-24-11-7-22(27)8-12-24/h5-12,17-18H,3-4,13-16H2,1-2H3/p+1 |
| InChIKey | OXDWPKWWDHUAOO-UHFFFAOYSA-O |
| XLogP | 4.96 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|