C10H15N3O — CID 138114943
3-(1,5-dimethylpyrazol-4-yl)-N,N-dimethylprop-2-enamide (PubChem CID 138114943) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is 3-(1,5-dimethylpyrazol-4-yl)-N,N-dimethylprop-2-enamide.
| Compound Name | 3-(1,5-dimethylpyrazol-4-yl)-N,N-dimethylprop-2-enamide |
|---|---|
| PubChem CID | 138114943 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | 3-(1,5-dimethylpyrazol-4-yl)-N,N-dimethylprop-2-enamide |
| SMILES | Cc1c(C=CC(=O)N(C)C)cnn1C |
| InChI | InChI=1S/C10H15N3O/c1-8-9(7-11-13(8)4)5-6-10(14)12(2)3/h5-7H,1-4H3 |
| InChIKey | OVRSJUGHSHHRRO-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|