C11H15N3O2 — CID 86816068
(E)-3-(1,5-dimethylpyrazol-4-yl)-1-(1,2-oxazolidin-2-yl)prop-2-en-1-one (PubChem CID 86816068) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is (E)-3-(1,5-dimethylpyrazol-4-yl)-1-(1,2-oxazolidin-2-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(1,5-dimethylpyrazol-4-yl)-1-(1,2-oxazolidin-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 86816068 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | (E)-3-(1,5-dimethylpyrazol-4-yl)-1-(1,2-oxazolidin-2-yl)prop-2-en-1-one |
| SMILES | Cc1c(/C=C/C(=O)N2CCCO2)cnn1C |
| InChI | InChI=1S/C11H15N3O2/c1-9-10(8-12-13(9)2)4-5-11(15)14-6-3-7-16-14/h4-5,8H,3,6-7H2,1-2H3/b5-4+ |
| InChIKey | ONGQUGHZBCFAAA-SNAWJCMRSA-N |
| XLogP | 0.91 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|